EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | C[C@H](O)C(=O)/C=C\c1cccc(O)c1CO |
| InChI | InChI=1S/C12H14O4/c1-8(14)11(15)6-5-9-3-2-4-12(16)10(9)7-13/h2-6,8,13-14,16H,7H2,1H3/b6-5-/t8-/m0/s1 |
| InChIKey | IFWNTXRIQDWBMQ-SLGIHZDVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sordaria macrospora (ncbitaxon:5147) | - | DOI (10.1515/znc-1989-9-1001) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sordariolone (CHEBI:221037) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (Z)-4-hydroxy-1-[3-hydroxy-2-(hydroxymethyl)phenyl]pent-1-en-3-one |