EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 172.011 |
| Monoisotopic Mass | 170.98538 |
| SMILES | N[C@@H](CC(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C4H7Cl2NO2/c5-3(6)1-2(7)4(8)9/h2-3H,1,7H2,(H,8,9)/t2-/m0/s1 |
| InChIKey | DGJTWBMINQYSMS-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (6030314) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Armentomycin (CHEBI:221029) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4,4-dichlorobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23365 | ChemSpider |