EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H23N6O6P |
| Net Charge | 0 |
| Average Mass | 354.304 |
| Monoisotopic Mass | 354.14167 |
| SMILES | COC(=O)C(O)P(=O)(O)N(C)NC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C10H23N6O6P/c1-16(23(20,21)9(19)8(18)22-2)15-7(17)6(11)4-3-5-14-10(12)13/h6,9,19H,3-5,11H2,1-2H3,(H,15,17)(H,20,21)(H4,12,13,14)/t6-,9?/m0/s1 |
| InChIKey | DDNXSURUODEJRT-AADKRJSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendofoliae (ncbitaxon:67314) | - | DOI (10.1016/S0040-4039(00)81904-8) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosfazinomycin B (CHEBI:221021) is a phosphonoacetic acid (CHEBI:15732) |
| IUPAC Name |
|---|
| N-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-(1-hydroxy-2-methoxy-2-oxoethyl)-N-methylphosphonamidic acid |
| Manual Xrefs | Databases |
|---|---|
| 30829969 | ChemSpider |