EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H33N7O7P |
| Net Charge | +1 |
| Average Mass | 454.445 |
| Monoisotopic Mass | 454.21736 |
| SMILES | COC(=O)C(O)[P+](O)(O)N(C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C15H32N7O7P/c1-8(2)10(16)12(24)20-9(6-5-7-19-15(17)18)11(23)21-22(3)30(27,28)14(26)13(25)29-4/h8-10,14,26-28H,5-7,16H2,1-4H3,(H5-,17,18,19,20,21,23,24)/p+1/t9-,10-,14?/m0/s1 |
| InChIKey | ZFYSKMMCBRAMFY-SRQCHHPUSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendofoliae (ncbitaxon:67314) | - | DOI (10.1016/S0040-4039(00)81904-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosfazinomycin A (CHEBI:221013) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-methylamino]-dihydroxy-(1-hydroxy-2-methoxy-2-oxoethyl)phosphanium |