EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O6 |
| Net Charge | 0 |
| Average Mass | 334.368 |
| Monoisotopic Mass | 334.14164 |
| SMILES | C[C@@H]1C[C@H]2O[C@@H]2CCCCC(=O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H22O6/c1-10-6-16-15(24-16)5-3-2-4-12(19)7-11-8-13(20)9-14(21)17(11)18(22)23-10/h8-10,15-16,20-21H,2-7H2,1H3/t10-,15-,16-/m1/s1 |
| InChIKey | YXPSTSCHAVSCKS-UHNFBRDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monocillium (ncbitaxon:581188) | - | DOI (10.1139/m80-133) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Monocillin V (CHEBI:221012) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (4R,6R,8R)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),16,18-triene-2,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 23338922 | ChemSpider |