EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42N10O8 |
| Net Charge | 0 |
| Average Mass | 646.706 |
| Monoisotopic Mass | 646.31871 |
| SMILES | CC(C)CC1NC(=O)[C@H](Cc2cncn2)N=C1N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](Cc1cncn1)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C28H42N10O8/c1-13(2)5-18-23(34-19(25(42)36-18)6-16-8-29-11-31-16)35-21(10-39)26(43)33-14(3)24(41)38-22(15(4)40)27(44)37-20(28(45)46)7-17-9-30-12-32-17/h8-9,11-15,18-22,39-40H,5-7,10H2,1-4H3,(H,29,31)(H,30,32)(H,33,43)(H,34,35)(H,36,42)(H,37,44)(H,38,41)(H,45,46)/t14-,15+,18?,19-,20-,21-,22-/m0/s1 |
| InChIKey | WIFLZTQPWWGHBD-PZKQBHIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (34659714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptamidine (CHEBI:220962) is a polypeptide (CHEBI:15841) |