EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39NO6 |
| Net Charge | 0 |
| Average Mass | 485.621 |
| Monoisotopic Mass | 485.27774 |
| SMILES | CCCCCCC/C=C/C=C/C(=O)CCc1c(O)c2c(c(C(=O)O)c1O)C(=O)N(CCC(C)C)C2 |
| InChI | InChI=1S/C28H39NO6/c1-4-5-6-7-8-9-10-11-12-13-20(30)14-15-21-25(31)22-18-29(17-16-19(2)3)27(33)23(22)24(26(21)32)28(34)35/h10-13,19,31-32H,4-9,14-18H2,1-3H3,(H,34,35)/b11-10+,13-12+ |
| InChIKey | MTRQOGAXJIIUAW-AQASXUMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria polymorpha (ncbitaxon:77046) | - | PubMed (29262728) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylactam D (CHEBI:220925) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-methylbutyl)-3-oxo-6-[(4E,6E)-3-oxotetradeca-4,6-dienyl]-1H-isoindole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435322 | ChemSpider |