EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29NO6 |
| Net Charge | 0 |
| Average Mass | 415.486 |
| Monoisotopic Mass | 415.19949 |
| SMILES | CCCCCCC/C=C/C=C/C(=O)CCc1c(O)c2c(c(C(=O)O)c1O)C(=O)NC2 |
| InChI | InChI=1S/C23H29NO6/c1-2-3-4-5-6-7-8-9-10-11-15(25)12-13-16-20(26)17-14-24-22(28)18(17)19(21(16)27)23(29)30/h8-11,26-27H,2-7,12-14H2,1H3,(H,24,28)(H,29,30)/b9-8+,11-10+ |
| InChIKey | RXRDBSDLVSHDGL-BNFZFUHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria polymorpha (ncbitaxon:77046) | - | PubMed (29262728) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylactam C (CHEBI:220919) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-oxo-6-[(4E,6E)-3-oxotetradeca-4,6-dienyl]-1,2-dihydroisoindole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435321 | ChemSpider |