EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O7 |
| Net Charge | 0 |
| Average Mass | 432.513 |
| Monoisotopic Mass | 432.21480 |
| SMILES | CCCCCCCCC/C=C/C(=O)CCc1c(O)c(C=O)c2c(c1O)C(=O)O[C@@H]2OC |
| InChI | InChI=1S/C24H32O7/c1-3-4-5-6-7-8-9-10-11-12-16(26)13-14-17-21(27)18(15-25)19-20(22(17)28)23(29)31-24(19)30-2/h11-12,15,24,27-28H,3-10,13-14H2,1-2H3/b12-11+/t24-/m0/s1 |
| InChIKey | YRXWGGJQBXWLGR-LCJITAHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria polymorpha (ncbitaxon:77046) | - | PubMed (29262728) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylaral B (CHEBI:220911) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-methoxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzouran-4-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 78435320 | ChemSpider |