EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4O2 |
| Net Charge | 0 |
| Average Mass | 172.188 |
| Monoisotopic Mass | 172.09603 |
| SMILES | NC1=NCC[C@@H]([C@@H](N)C(=O)O)N1 |
| InChI | InChI=1S/C6H12N4O2/c7-4(5(11)12)3-1-2-9-6(8)10-3/h3-4H,1-2,7H2,(H,11,12)(H3,8,9,10)/t3-,4+/m0/s1 |
| InChIKey | XHNWDEHKMJLKGG-IUYQGCFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (33151679) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-Capreomycidin (CHEBI:220901) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R)-2-amino-2-[(6S)-2-amino-1,4,5,6-tetrahydropyrimidin-6-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 61452975 | ChemSpider |