EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25N3O5 |
| Net Charge | 0 |
| Average Mass | 435.480 |
| Monoisotopic Mass | 435.17942 |
| SMILES | C=CC(C)(C)N(OC(C)=O)c1ccccc1C(=O)N[C@H]1CC(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C24H25N3O5/c1-5-24(3,4)27(32-15(2)28)20-13-9-7-11-17(20)22(30)26-19-14-21(29)16-10-6-8-12-18(16)25-23(19)31/h5-13,19H,1,14H2,2-4H3,(H,25,31)(H,26,30)/t19-/m0/s1 |
| InChIKey | KQLIGKHQVCGLRG-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nanangensis (ncbitaxon:2582783) | - | PubMed (32182055) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nanangelenin F (CHEBI:220836) is a N-acyl-amino acid (CHEBI:51569) |