EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17N3O3 |
| Net Charge | 0 |
| Average Mass | 323.352 |
| Monoisotopic Mass | 323.12699 |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ccccc2N)CC(=O)c2ccccc21 |
| InChI | InChI=1S/C18H17N3O3/c1-21-15-9-5-3-7-12(15)16(22)10-14(18(21)24)20-17(23)11-6-2-4-8-13(11)19/h2-9,14H,10,19H2,1H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | WJGJAVYYWOXAKJ-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nanangensis (ncbitaxon:2582783) | - | PubMed (32182055) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nanangelenin D (CHEBI:220825) is a N-acyl-amino acid (CHEBI:51569) |