EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N3O5 |
| Net Charge | 0 |
| Average Mass | 449.507 |
| Monoisotopic Mass | 449.19507 |
| SMILES | C=CC(C)(C)N(OC(C)=O)c1ccccc1C(=O)N[C@H]1CC(=O)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C25H27N3O5/c1-6-25(3,4)28(33-16(2)29)21-14-10-8-12-18(21)23(31)26-19-15-22(30)17-11-7-9-13-20(17)27(5)24(19)32/h6-14,19H,1,15H2,2-5H3,(H,26,31)/t19-/m0/s1 |
| InChIKey | ZFMRDGPKNSRRND-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nanangensis (ncbitaxon:2582783) | - | PubMed (32182055) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nanangelenin A (CHEBI:220811) is a N-acyl-amino acid (CHEBI:51569) |