EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46N10O9S |
| Net Charge | 0 |
| Average Mass | 722.826 |
| Monoisotopic Mass | 722.31699 |
| SMILES | CC=C1NC(=O)C(NC(=O)[C@H](C)N)CC2(CSC=CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC2=O)NC(=O)[C@H]([C@@H](C)CC)NC1=O |
| InChI | InChI=1S/C30H46N10O9S/c1-5-14(3)22-28(48)40-30(12-19(37-23(43)15(4)31)27(47)35-16(6-2)25(45)39-22)13-50-10-9-34-24(44)18(11-21(33)42)36-26(46)17(38-29(30)49)7-8-20(32)41/h6,9-10,14-15,17-19,22H,5,7-8,11-13,31H2,1-4H3,(H2,32,41)(H2,33,42)(H,34,44)(H,35,47)(H,36,46)(H,37,43)(H,38,49)(H,39,45)(H,40,48)/t14-,15-,17-,18-,19?,22-,30?/m0/s1 |
| InChIKey | UVECDZYCKPCJRP-GWFNZOGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies TP-A0584 (ncbitaxon:314563) | - | PubMed (32719482) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goadpeptin B (CHEBI:220766) is a polypeptide (CHEBI:15841) |