EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38O7 |
| Net Charge | 0 |
| Average Mass | 510.627 |
| Monoisotopic Mass | 510.26175 |
| SMILES | CC(CC(=O)CC(C)(O)C1=CC(=O)[C@@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC(=O)[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H38O7/c1-16(25(35)36)12-17(31)15-28(5,37)21-14-24(34)29(6)18-8-9-20-26(2,3)22(32)10-11-27(20,4)19(18)13-23(33)30(21,29)7/h8,13-14,16,20,37H,9-12,15H2,1-7H3,(H,35,36)/t16?,20-,27+,28?,29+,30-/m0/s1 |
| InChIKey | JFCYOZDABVWLAB-OGJFIDDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma australe (ncbitaxon:34457) | - | PubMed (28931319) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxy-3,12,15,23-tetraoxolanosta-7,9(11),16-trien-26-oic acid (CHEBI:220758) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| 6-hydroxy-2-methyl-4-oxo-6-[(5R,10S,13R,14S)-4,4,10,13,14-pentamethyl-3,12,15-trioxo-1,2,5,6-tetrahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439559 | ChemSpider |