EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N3O3 |
| Net Charge | 0 |
| Average Mass | 309.325 |
| Monoisotopic Mass | 309.11134 |
| SMILES | Nc1ccccc1C(=O)N[C@@H]1CC(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C17H15N3O3/c18-12-7-3-1-5-10(12)16(22)20-14-9-15(21)11-6-2-4-8-13(11)19-17(14)23/h1-8,14H,9,18H2,(H,19,23)(H,20,22)/t14-/m1/s1 |
| InChIKey | TVPLZAQWRYWFFT-CQSZACIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus ATCC 20542 (ncbitaxon:285217) | - | PubMed (32843555) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-terreazepine (CHEBI:220681) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-amino-N-[(3R)-2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl]benzamide |