EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8NO5PS |
| Net Charge | 0 |
| Average Mass | 201.140 |
| Monoisotopic Mass | 200.98608 |
| SMILES | N[C@@H](CSP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C3H8NO5PS/c4-2(3(5)6)1-11-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 |
| InChIKey | MNEMQJJMDDZXRO-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-phospho-L-cysteine (CHEBI:22066) is a S-substituted L-cysteine (CHEBI:47910) |
| S-phospho-L-cysteine (CHEBI:22066) is a organic thiophosphate (CHEBI:37512) |
| S-phospho-L-cysteine (CHEBI:22066) is a phosphoamino acid (CHEBI:26051) |
| Incoming Relation(s) |
| S-phospho-L-cysteine residue (CHEBI:61956) is substituent group from S-phospho-L-cysteine (CHEBI:22066) |
| IUPAC Name |
|---|
| S-phosphono-L-cysteine |
| Synonyms | Source |
|---|---|
| S-phosphocysteine | ChemIDplus |
| S-phosphonocysteine | ChEBI |
| (R)-2-amino-3-phosphothiopropanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB03544 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20197894 | Reaxys |
| CAS:115562-30-6 | ChemIDplus |