EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | CC1=CC(=O)[C@]2(C/C=C(\C)CCC(=O)O)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C14H18O5/c1-8(3-4-11(16)17)5-6-14-10(15)7-9(2)12(18)13(14)19-14/h5,7,12-13,18H,3-4,6H2,1-2H3,(H,16,17)/b8-5+/t12-,13-,14+/m1/s1 |
| InChIKey | SFHMKUALUHIBHB-BIHARUESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies F23-2 (ncbitaxon:543960) | - | PubMed (26540093) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicyclone E (CHEBI:220641) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-6-[(1R,5R,6R)-5-hydroxy-4-methyl-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-4-methylhex-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 44210807 | ChemSpider |