EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O4 |
| Net Charge | 0 |
| Average Mass | 428.613 |
| Monoisotopic Mass | 428.29266 |
| SMILES | C[C@H](CCC(=O)O)[C@H]1C[C@H](O)[C@@]2(C)C3=CCC4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C27H40O4/c1-16(7-10-23(30)31)19-15-22(29)27(6)18-8-9-20-24(2,3)21(28)12-13-25(20,4)17(18)11-14-26(19,27)5/h8,11,16,19-20,22,29H,7,9-10,12-15H2,1-6H3,(H,30,31)/t16-,19-,20?,22+,25-,26-,27-/m1/s1 |
| InChIKey | PWADAHTZZKLCAK-XRNZNSMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma sinense (ncbitaxon:36075) | - | PubMed (22161763) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganoderic acid Jd (CHEBI:220552) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441181 | ChemSpider |