EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:220530 - Pyrichalasin H
| Formula | C31H41NO6 |
| Net Charge | 0 |
| Average Mass | 523.670 |
| Monoisotopic Mass | 523.29339 |
| SMILES | C=C1C(C)C2C(Cc3ccc(OC)cc3)NC(=O)C23C(OC(C)=O)/C=C/C(C)(O)CC(C)C/C=C/C3C1O |
| InChI | InChI=1S/C31H41NO6/c1-18-8-7-9-24-28(34)20(3)19(2)27-25(16-22-10-12-23(37-6)13-11-22)32-29(35)31(24,27)26(38-21(4)33)14-15-30(5,36)17-18/h7,9-15,18-19,24-28,34,36H,3,8,16-17H2,1-2,4-6H3,(H,32,35)/b9-7+,15-14+ |
| InChIKey | AECZOENDDUTONS-PWSPGYJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pyricularia grisea (ncbitaxon:148305) | - | DOI (10.1271/bbb1961.51.2625) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrichalasin H (CHEBI:220530) has role fungal metabolite (CHEBI:76946) |
| Pyrichalasin H (CHEBI:220530) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| [(3E,9E)-5,12-dihydroxy-16-[(4-methoxyphenyl)methyl]-5,7,14-trimethyl-13-methylidene-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 4946854 | ChemSpider |