EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO3 |
| Net Charge | 0 |
| Average Mass | 247.294 |
| Monoisotopic Mass | 247.12084 |
| SMILES | C[C@@H](CC/C=C/C=C/C=C/c1cnco1)C(=O)O |
| InChI | InChI=1S/C14H17NO3/c1-12(14(16)17)8-6-4-2-3-5-7-9-13-10-15-11-18-13/h2-5,7,9-12H,6,8H2,1H3,(H,16,17)/b4-2+,5-3+,9-7+/t12-/m0/s1 |
| InChIKey | REIWTCOUEQYEGR-WINGKEEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (30598544) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxazoltriene acid (CHEBI:220519) is a heterocyclic fatty acid (CHEBI:48847) |