EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO4S |
| Net Charge | 0 |
| Average Mass | 323.414 |
| Monoisotopic Mass | 323.11913 |
| SMILES | C/C=C/C=C\C(=O)N[C@@H](CCSC(=O)/C=C\C=C\C)C(=O)O |
| InChI | InChI=1S/C16H21NO4S/c1-3-5-7-9-14(18)17-13(16(20)21)11-12-22-15(19)10-8-6-4-2/h3-10,13H,11-12H2,1-2H3,(H,17,18)(H,20,21)/b5-3+,6-4+,9-7-,10-8-/t13-/m0/s1 |
| InChIKey | OCTNNAIBEKZOPK-BWLIDFMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Punctularia strigosozonata (ncbitaxon:202698) | - | PubMed (31051070) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Compound 5 (CHEBI:220497) is a N-acyl-L-amino acid (CHEBI:21644) |