EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO4S |
| Net Charge | 0 |
| Average Mass | 309.387 |
| Monoisotopic Mass | 309.10348 |
| SMILES | C/C=C/C=C\C(=O)N[C@@H](CSC(=O)/C=C\C=C\C)C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-3-5-7-9-13(17)16-12(15(19)20)11-21-14(18)10-8-6-4-2/h3-10,12H,11H2,1-2H3,(H,16,17)(H,19,20)/b5-3+,6-4+,9-7-,10-8-/t12-/m0/s1 |
| InChIKey | CLLGOQVRTAPAPN-QBUJVCQNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Compound 4 (CHEBI:220491) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2R)-2-[[(2Z,4E)-hexa-2,4-dienoyl]amino]-3-[(2Z,4E)-hexa-2,4-dienoyl]sulanylpropanoic acid |