EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO5 |
| Net Charge | 0 |
| Average Mass | 361.438 |
| Monoisotopic Mass | 361.18892 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)C(=C(O)[C@@H]2[C@H]3CCCC[C@H]3C=C[C@H]2C(=O)O)C1=O |
| InChI | InChI=1S/C20H27NO5/c1-3-10(2)16-18(23)15(19(24)21-16)17(22)14-12-7-5-4-6-11(12)8-9-13(14)20(25)26/h8-14,16,22H,3-7H2,1-2H3,(H,21,24)(H,25,26)/t10-,11-,12-,13+,14+,16-/m0/s1 |
| InChIKey | PMBMUQRFNVZUDB-HFVXDEDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces variabilis (ncbitaxon:28576) | - | PubMed (30609896) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Varicidin B (CHEBI:220485) is a heterocyclic fatty acid (CHEBI:48847) |