EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO5 |
| Net Charge | 0 |
| Average Mass | 375.465 |
| Monoisotopic Mass | 375.20457 |
| SMILES | CC[C@H](C)[C@H]1C(=O)C(=C(O)[C@@H]2[C@H]3CCCC[C@H]3C=C[C@H]2C(=O)O)C(=O)N1C |
| InChI | InChI=1S/C21H29NO5/c1-4-11(2)17-19(24)16(20(25)22(17)3)18(23)15-13-8-6-5-7-12(13)9-10-14(15)21(26)27/h9-15,17,23H,4-8H2,1-3H3,(H,26,27)/t11-,12-,13-,14+,15+,17-/m0/s1 |
| InChIKey | SKXOEWAUSCYCSA-YDVRFCCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces variabilis (ncbitaxon:28576) | - | PubMed (30609896) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Varicidin A (CHEBI:220479) is a heterocyclic fatty acid (CHEBI:48847) |