EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O2 |
| Net Charge | 0 |
| Average Mass | 194.274 |
| Monoisotopic Mass | 194.13068 |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C12H18O2/c1-4-10(2)9-11(3)7-5-6-8-12(13)14/h5-10H,4H2,1-3H3,(H,13,14)/b7-5+,8-6+,11-9+/t10-/m0/s1 |
| InChIKey | LXNHZKFVVKUCQE-GNSHKHSOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dictyopanus (ncbitaxon:135781) | - | PubMed (11079807) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E,6E)-6,8-dimethyldeca-2,4,6-trienoic acid (CHEBI:220463) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-6,8-dimethyldeca-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8783233 | ChemSpider |