EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO2S |
| Net Charge | 0 |
| Average Mass | 393.637 |
| Monoisotopic Mass | 393.27015 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C23H39NO2S/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-16-27-17-22(24)23(25)26/h9,11,13,15,22H,6-8,10,12,14,16-17,24H2,1-5H3,(H,25,26)/b19-11+,20-13+,21-15+/t22-/m0/s1 |
| InChIKey | ZVHYBHXYDZELLD-REPDADMKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-geranylgeranyl-L-cysteine (CHEBI:22046) is a S-polyprenyl-L-cysteine (CHEBI:13796) |
| S-geranylgeranyl-L-cysteine (CHEBI:22046) is tautomer of S-[(2E,6E,10E)-geranylgeranyl]-L-cysteine zwitterion (CHEBI:189554) |
| Incoming Relation(s) |
| S-geranylgeranyl-L-cysteine residue (CHEBI:86021) is substituent group from S-geranylgeranyl-L-cysteine (CHEBI:22046) |
| S-[(2E,6E,10E)-geranylgeranyl]-L-cysteine zwitterion (CHEBI:189554) is tautomer of S-geranylgeranyl-L-cysteine (CHEBI:22046) |
| IUPAC Name |
|---|
| S-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]-L-cysteine |
| Synonyms | Source |
|---|---|
| S-geranylgeranylcysteine | ChEBI |
| Geranylgeranylcysteine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-12591 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9958844 | Reaxys |
| CAS:131404-69-8 | ChemIDplus |