EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N5O9 |
| Net Charge | 0 |
| Average Mass | 493.473 |
| Monoisotopic Mass | 493.18088 |
| SMILES | CC(=O)c1cn(C2OC(C(NC(=O)C(N)C(C)C(O)c3ccccn3)C(=O)O)C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C21H27N5O9/c1-8(14(28)10-5-3-4-6-23-10)12(22)18(31)25-13(20(32)33)17-15(29)16(30)19(35-17)26-7-11(9(2)27)24-21(26)34/h3-8,12-17,19,28-30H,22H2,1-2H3,(H,24,34)(H,25,31)(H,32,33) |
| InChIKey | ICXJRQHWJJTKQI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces tendae (ncbitaxon:1932) | - | PubMed (10470685) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nikkomycin Lx (CHEBI:220436) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[5-(5-acetyl-2-oxo-1H-imidazol-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-[(2-amino-4-hydroxy-3-methyl-4-pyridin-2-ylbutanoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78444903 | ChemSpider |