EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O6S |
| Net Charge | 0 |
| Average Mass | 292.313 |
| Monoisotopic Mass | 292.07291 |
| SMILES | CC(=O)N(C(=O)NCCCC(=O)O)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C10H16N2O6S/c1-6(13)12(7(5-19)9(16)17)10(18)11-4-2-3-8(14)15/h7,19H,2-5H2,1H3,(H,11,18)(H,14,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | WBVIQNAQZBSZKJ-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces venezuelae ATCC 10712 (ncbitaxon:953739) | - | DOI (10.1039/c3sc52536h) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gaburedin E (CHEBI:220435) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| 4-[[acetyl-[(1R)-1-carboxy-2-sulanylethyl]carbamoyl]amino]butanoic acid |