EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5N3O3 |
| Net Charge | 0 |
| Average Mass | 191.146 |
| Monoisotopic Mass | 191.03309 |
| SMILES | N#C/N=[N+](\[O-])c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H5N3O3/c9-5-10-11(14)7-3-1-6(2-4-7)8(12)13/h1-4H,(H,12,13)/b11-10- |
| InChIKey | LDRFVNKBORCKQS-KHPPLWFESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calvatia (ncbitaxon:68761) | - | PubMed (1126871) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calvatic acid (CHEBI:220412) is a benzoic acids (CHEBI:22723) |