EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H37N5O6 |
| Net Charge | 0 |
| Average Mass | 575.666 |
| Monoisotopic Mass | 575.27438 |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)N[C@H]1CO |
| InChI | InChI=1S/C31H37N5O6/c37-19-24-27(38)32-22(17-20-9-3-1-4-10-20)30(41)35-15-7-13-25(35)28(39)33-23(18-21-11-5-2-6-12-21)31(42)36-16-8-14-26(36)29(40)34-24/h1-6,9-12,22-26,37H,7-8,13-19H2,(H,32,38)(H,33,39)(H,34,40)/t22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | DNTOQRXOEOKTNW-LROMGURASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/j.tet.2011.07.003) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Versicoloritide C (CHEBI:220407) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,12S,15S,18S)-3,12-dibenzyl-15-(hydroxymethyl)-1,4,10,13,16-pentazatricyclo[16.3.0.06,10]henicosane-2,5,11,14,17-pentone |
| Manual Xrefs | Databases |
|---|---|
| 29214487 | ChemSpider |