EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O5 |
| Net Charge | 0 |
| Average Mass | 366.413 |
| Monoisotopic Mass | 366.14672 |
| SMILES | C=C=CCOc1ccc(COc2ccc(/C=C/C(=O)OC)cc2OC)cc1 |
| InChI | InChI=1S/C22H22O5/c1-4-5-14-26-19-10-6-18(7-11-19)16-27-20-12-8-17(15-21(20)24-2)9-13-22(23)25-3/h5-13,15H,1,14,16H2,2-3H3/b13-9+ |
| InChIKey | JNJBCXBDGFTVKB-UKTHLTGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylariaspecies (ncbitaxon:1715255) | - | PubMed (18569699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7E)-3-[4-(4-buta-2,3-dienyloxy-benzyloxy)-3-methoxy-phenyl]-acrylic acid methyl ester (CHEBI:220400) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| 23286367 | ChemSpider |