EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O8 |
| Net Charge | 0 |
| Average Mass | 438.437 |
| Monoisotopic Mass | 438.17506 |
| SMILES | CC(=O)N(O)CCCCNC(=O)[C@H](CO)NC(=O)[C@@H]1COC(c2cccc(O)c2O)=N1 |
| InChI | InChI=1S/C19H26N4O8/c1-11(25)23(30)8-3-2-7-20-17(28)13(9-24)21-18(29)14-10-31-19(22-14)12-5-4-6-15(26)16(12)27/h4-6,13-14,24,26-27,30H,2-3,7-10H2,1H3,(H,20,28)(H,21,29)/t13-,14-/m0/s1 |
| InChIKey | WWDGEKDKGZGKAG-KBPBESRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter baumannii ATCC 17978 (ncbitaxon:400667) | - | PubMed (23456955) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fimsbactin F (CHEBI:220389) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (4S)-N-[(2S)-1-[4-[acetyl(hydroxy)amino]butylamino]-3-hydroxy-1-oxopropan-2-yl]-2-(2,3-dihydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78440283 | ChemSpider |