EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H69N7O10 |
| Net Charge | 0 |
| Average Mass | 771.998 |
| Monoisotopic Mass | 771.51059 |
| SMILES | CC[C@H](C)[C@@H](CC(=O)[C@H](C)NC(=O)CCCN)C(=O)N[C@H](CO)C(=O)N[C@@H](C(=O)N[C@H](CO)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)CC(C)C)C(C)C |
| InChI | InChI=1S/C37H69N7O10/c1-10-23(8)26(16-30(48)24(9)39-31(49)12-11-13-38)33(50)42-29(19-47)36(53)44-32(22(6)7)37(54)43-28(18-46)35(52)41-27(15-21(4)5)34(51)40-25(17-45)14-20(2)3/h20-29,32,45-47H,10-19,38H2,1-9H3,(H,39,49)(H,40,51)(H,41,52)(H,42,50)(H,43,54)(H,44,53)/t23-,24-,25-,26+,27+,28+,29+,32+/m0/s1 |
| InChIKey | IYNDWBXTRNUZEP-SZODUKSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (30804501) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusaoctaxin A (CHEBI:220359) is a polypeptide (CHEBI:15841) |