EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O7 |
| Net Charge | 0 |
| Average Mass | 382.368 |
| Monoisotopic Mass | 382.10525 |
| SMILES | Cc1cc(O)c2oc3c(O)c(O)cc(C)c3c3c(C)cc(O)c(O)c3oc2c1 |
| InChI | InChI=1S/C21H18O7/c1-8-4-13(24)19-14(5-8)27-20-15(9(2)6-11(22)17(20)25)16-10(3)7-12(23)18(26)21(16)28-19/h4-7,22-26H,1-3H3 |
| InChIKey | PSZMLNIAWXBYSK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphis (ncbitaxon:71599) | - | PubMed (12843584) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rikuzenol (CHEBI:220331) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 3,12,20-trimethyl-8,15-dioxatetracyclo[14.4.0.02,7.09,14]icosa-1(16),2(7),3,5,9,11,13,17,19-nonaene-5,6,10,17,18-pentol |
| Manual Xrefs | Databases |
|---|---|
| 9167768 | ChemSpider |