EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O8S2 |
| Net Charge | 0 |
| Average Mass | 470.525 |
| Monoisotopic Mass | 470.08176 |
| SMILES | CO[C@@H]1[C@@H]2[C@@H](C[C@@]34SS[C@]5(C[C@H]6C(=O)C[C@H](O)[C@H](O)[C@H]6N5C3=O)C(=O)N24)C(=O)C[C@@H]1O |
| InChI | InChI=1S/C19H22N2O8S2/c1-29-15-11(25)3-9(23)7-5-19-16(27)20-12-6(8(22)2-10(24)14(12)26)4-18(20,30-31-19)17(28)21(19)13(7)15/h6-7,10-15,24-26H,2-5H2,1H3/t6-,7-,10-,11-,12-,13-,14-,15-,18+,19+/m0/s1 |
| InChIKey | WHCJAHUVMGPUOK-NCRURJJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schizophyllum (ncbitaxon:5333) | - | PubMed (28076985) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epicoccin U (CHEBI:220329) is a 2,5-diketopiperazines (CHEBI:65061) |
| Epicoccin U (CHEBI:220329) is a indoles (CHEBI:24828) |
| Epicoccin U (CHEBI:220329) is a organic disulfide (CHEBI:35489) |
| Epicoccin U (CHEBI:220329) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4S,5R,6S,9R,11R,14S,15R,16S,19R)-5,6,16-trihydroxy-15-methoxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosane-2,8,12,18-tetrone |