EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H43N7O8 |
| Net Charge | 0 |
| Average Mass | 605.693 |
| Monoisotopic Mass | 605.31731 |
| SMILES | CC[C@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)c1cc(O)ccc1O)[C@@H](C)CC)C(=O)O |
| InChI | InChI=1S/C28H43N7O8/c1-4-15(3)22(25(40)32-18(5-2)27(42)43)34-24(39)20-9-7-13-35(20)26(41)19(8-6-12-31-28(29)30)33-23(38)17-14-16(36)10-11-21(17)37/h10-11,14-15,18-20,22,36-37H,4-9,12-13H2,1-3H3,(H,32,40)(H,33,38)(H,34,39)(H,42,43)(H4,29,30,31)/t15-,18-,19-,20-,22-/m0/s1 |
| InChIKey | WNCIWSMKRPFIJY-BTAJCFKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Candidatus Entotheonella factor (ncbitaxon:1429438) | - | PubMed (24476823) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nazumamide A (CHEBI:220327) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3S)-2-[[(2S)-1-[(2S)-5-(diaminomethylideneamino)-2-[(2,5-dihydroxybenzoyl)amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8184397 | ChemSpider |