EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31N3O7 |
| Net Charge | 0 |
| Average Mass | 401.460 |
| Monoisotopic Mass | 401.21620 |
| SMILES | CC[C@H](C)[C@H](C(=O)OC)[C@@H](O)C(=O)N[C@H]1C[C@@H]1C[C@H](NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C18H31N3O7/c1-5-8(2)13(18(27)28-4)14(22)16(24)20-11-6-10(11)7-12(17(25)26)21-15(23)9(3)19/h8-14,22H,5-7,19H2,1-4H3,(H,20,24)(H,21,23)(H,25,26)/t8-,9-,10+,11-,12-,13-,14+/m0/s1 |
| InChIKey | GZUZMJQLRANFIY-DDASBUEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (10724015) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Belactosin B (CHEBI:220299) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-[(1R,2S)-2-[[(2R,3S,4S)-2-hydroxy-3-methoxycarbonyl-4-methylhexanoyl]amino]cyclopropyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438201 | ChemSpider |