EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O4 |
| Net Charge | 0 |
| Average Mass | 396.527 |
| Monoisotopic Mass | 396.23006 |
| SMILES | C/C=C(\C)[C@@]1(O)C(/C=C/C=C(C)\C=C\C=C\C(=O)O)[C@@H]2CC=C(C)C[C@H]2[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C25H32O4/c1-5-18(4)25(28)21(11-8-10-16(2)9-6-7-12-22(26)27)19-14-13-17(3)15-20(19)23-24(25)29-23/h5-13,19-21,23-24,28H,14-15H2,1-4H3,(H,26,27)/b9-6+,11-8+,12-7+,16-10-,18-5+/t19-,20-,21?,23+,24+,25-/m1/s1 |
| InChIKey | RFLQWGOTYZWRJB-WSWMBLLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthracobiaspecies (ncbitaxon:2709752) | - | PubMed (17193260) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anthracobic acid B (CHEBI:220289) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6Z,8E)-9-[(1aS,2S,3aR,7aR,7bS)-2-[(E)-but-2-en-2-yl]-2-hydroxy-6-methyl-3,3a,4,7,7a,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-3-yl]-6-methylnona-2,4,6,8-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443606 | ChemSpider |