EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | C=CC1CCC2=C([C@H](O)C(=O)[C@]3(O)C2CCCC3(C)C)[C@H]1O |
| InChI | InChI=1S/C18H26O4/c1-4-10-7-8-11-12-6-5-9-17(2,3)18(12,22)16(21)15(20)13(11)14(10)19/h4,10,12,14-15,19-20,22H,1,5-9H2,2-3H3/t10?,12?,14-,15-,18+/m0/s1 |
| InChIKey | GHIOOVSMRJABRE-YGDJSBAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypella (ncbitaxon:140192) | - | PubMed (22611352) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopararane G (CHEBI:220261) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,8aS,10S)-2-ethenyl-1,8a,10-trihydroxy-8,8-dimethyl-2,3,4,4b,5,6,7,10-octahydro-1H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78438734 | ChemSpider |