EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37NO3 |
| Net Charge | 0 |
| Average Mass | 387.564 |
| Monoisotopic Mass | 387.27734 |
| SMILES | CC1=C[C@@H]2/C=C(\C)CC[C@@H](O)CCCC(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C24H37NO3/c1-14(2)11-20-22-17(5)16(4)13-18-12-15(3)9-10-19(26)7-6-8-21(27)24(18,22)23(28)25-20/h12-14,17-20,22,26H,6-11H2,1-5H3,(H,25,28)/b15-12+/t17-,18+,19+,20+,22+,24-/m1/s1 |
| InChIKey | NIEDFZZUOAIQKN-IESOGHJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine H (CHEBI:220258) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine H (CHEBI:220258) is a cytochalasin (CHEBI:23528) |