EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O5 |
| Net Charge | 0 |
| Average Mass | 320.385 |
| Monoisotopic Mass | 320.16237 |
| SMILES | C=CC1C=C2C(=O)C(O)=C3C(CCC(O)C3(C)C)[C@@]2(O)[C@H](O)C1 |
| InChI | InChI=1S/C18H24O5/c1-4-9-7-11-15(21)16(22)14-10(18(11,23)13(20)8-9)5-6-12(19)17(14,2)3/h4,7,9-10,12-13,19-20,22-23H,1,5-6,8H2,2-3H3/t9?,10?,12?,13-,18+/m1/s1 |
| InChIKey | HXKUYVGKSNPPHQ-HSKOCGKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypella (ncbitaxon:140192) | - | PubMed (22611352) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopararane E (CHEBI:220256) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4bS,5R)-7-ethenyl-2,4b,5,10-tetrahydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78443766 | ChemSpider |