EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O4 |
| Net Charge | 0 |
| Average Mass | 300.354 |
| Monoisotopic Mass | 300.13616 |
| SMILES | Cc1cc(O)c2c(c1)[C@H](O)[C@H]1OC(=O)[C@]3(C)CC[C@@H]4C[C@@]24[C@H]13 |
| InChI | InChI=1S/C18H20O4/c1-8-5-10-12(11(19)6-8)18-7-9(18)3-4-17(2)15(18)14(13(10)20)22-16(17)21/h5-6,9,13-15,19-20H,3-4,7H2,1-2H3/t9-,13+,14-,15-,17-,18+/m1/s1 |
| InChIKey | VZCXUHPOIGXDPZ-MYCDKFDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthriniumspecies (ncbitaxon:1756131) | - | PubMed (21741249) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arthrinin C (CHEBI:220255) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,8S,9S,12R,15R,17S)-3,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadeca-2(7),3,5-trien-11-one |
| Manual Xrefs | Databases |
|---|---|
| 26633806 | ChemSpider |