EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37NO4 |
| Net Charge | 0 |
| Average Mass | 403.563 |
| Monoisotopic Mass | 403.27226 |
| SMILES | CC1=C[C@@H]2/C=C(\C)CC[C@@H](O)[C@@H](O)CCC(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C24H37NO4/c1-13(2)10-18-22-16(5)15(4)12-17-11-14(3)6-7-19(26)20(27)8-9-21(28)24(17,22)23(29)25-18/h11-13,16-20,22,26-27H,6-10H2,1-5H3,(H,25,29)/b14-11+/t16-,17+,18+,19-,20+,22+,24-/m1/s1 |
| InChIKey | WVAXKHYCMQJANQ-YHJNQPEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine G (CHEBI:220254) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine G (CHEBI:220254) is a cytochalasin (CHEBI:23528) |