EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39NO5 |
| Net Charge | 0 |
| Average Mass | 433.589 |
| Monoisotopic Mass | 433.28282 |
| SMILES | CO[C@@H]1CC(=O)[C@@]23C(=O)N[C@@H](CC(C)C)[C@@H]2[C@H](C)C(C)=C[C@@H]3/C=C(\C)CC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H39NO5/c1-13(2)9-18-22-16(5)15(4)11-17-10-14(3)7-8-19(27)23(29)20(31-6)12-21(28)25(17,22)24(30)26-18/h10-11,13,16-20,22-23,27,29H,7-9,12H2,1-6H3,(H,26,30)/b14-10+/t16-,17+,18+,19-,20-,22+,23-,25-/m1/s1 |
| InChIKey | VMCFTVWDHVWSOB-LKZIPFRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine F (CHEBI:220250) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine F (CHEBI:220250) is a cytochalasin (CHEBI:23528) |