EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O4 |
| Net Charge | 0 |
| Average Mass | 304.386 |
| Monoisotopic Mass | 304.16746 |
| SMILES | C=CC1C=C2C(=O)C(O)=C3C(CCC(O)C3(C)C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C18H24O4/c1-4-10-7-8-18(22)11-5-6-13(19)17(2,3)14(11)16(21)15(20)12(18)9-10/h4,9-11,13,19,21-22H,1,5-8H2,2-3H3/t10?,11?,13?,18-/m0/s1 |
| InChIKey | RBCSLMHDDJQRHE-GNTHLIOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypella (ncbitaxon:140192) | - | PubMed (22611352) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopararane D (CHEBI:220249) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4bS)-7-ethenyl-2,4b,10-trihydroxy-1,1-dimethyl-3,4,4a,5,6,7-hexahydro-2H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78443765 | ChemSpider |