EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO5 |
| Net Charge | 0 |
| Average Mass | 415.530 |
| Monoisotopic Mass | 415.23587 |
| SMILES | CC1=C[C@@H]2[C@@H]3[C@H](C(=O)[C@H]4CC[C@]3(C)O4)[C@@H](O)C(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C24H33NO5/c1-10(2)8-14-17-12(4)11(3)9-13-18-16(19(26)15-6-7-23(18,5)30-15)20(27)21(28)24(13,17)22(29)25-14/h9-10,12-18,20,27H,6-8H2,1-5H3,(H,25,29)/t12-,13-,14+,15-,16-,17+,18-,20-,23+,24+/m1/s1 |
| InChIKey | AUNPAALTSVXOPF-XMESRAGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine D (CHEBI:220241) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine D (CHEBI:220241) is a cytochalasin (CHEBI:23528) |