EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31NO3S |
| Net Charge | 0 |
| Average Mass | 341.517 |
| Monoisotopic Mass | 341.20246 |
| SMILES | C/C(=C/CC/C(C)=C/CC/C(C)=C/CSC[C@H](N)C(=O)O)CO |
| InChI | InChI=1S/C18H31NO3S/c1-14(7-5-9-16(3)12-20)6-4-8-15(2)10-11-23-13-17(19)18(21)22/h6,9-10,17,20H,4-5,7-8,11-13,19H2,1-3H3,(H,21,22)/b14-6+,15-10+,16-9-/t17-/m0/s1 |
| InChIKey | BFUAGAALIMPCLW-IJXSMPQSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-12-hydroxyfarnesyl-L-cysteine (CHEBI:22024) has functional parent S-farnesyl-L-cysteine (CHEBI:22043) |
| S-12-hydroxyfarnesyl-L-cysteine (CHEBI:22024) is a L-cysteine thioether (CHEBI:27532) |
| IUPAC Name |
|---|
| S-[(2E,6E,10Z)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-L-cysteine |
| Synonyms | Source |
|---|---|
| 2-amino-3-(12-hydroxy-3,7,11-trimethyl-3,6,10-dodecatrienylthio)propanoic acid | RESID |
| S-(2E,6E,10Z)-farnesyl-L-cysteine | ChEBI |
| S-(E,E,Z)-farnesyl-L-cysteine | ChEBI |
| (R,E,E,Z)-2-amino-3-(12-hydroxy-3,7,11-trimethyl-3,6,10-dodecatrienylsulfanyl)propanoic acid | RESID |
| Manual Xrefs | Databases |
|---|---|
| AA0103 | RESID |