EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37NO4 |
| Net Charge | 0 |
| Average Mass | 403.563 |
| Monoisotopic Mass | 403.27226 |
| SMILES | CC1=C[C@@H]2[C@@H]3[C@H](CC(=O)[C@]24C(=O)N[C@@H](CC(C)C)[C@@H]4[C@@H]1C)C[C@H](O)CC[C@@]3(C)O |
| InChI | InChI=1S/C24H37NO4/c1-12(2)8-18-20-14(4)13(3)9-17-21-15(10-16(26)6-7-23(21,5)29)11-19(27)24(17,20)22(28)25-18/h9,12,14-18,20-21,26,29H,6-8,10-11H2,1-5H3,(H,25,28)/t14-,15+,16-,17-,18+,20+,21+,23-,24-/m1/s1 |
| InChIKey | WEAPJLXBXJHVBY-AZUBXMTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine B (CHEBI:220230) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine B (CHEBI:220230) is a cytochalasin (CHEBI:23528) |