EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33NO5 |
| Net Charge | 0 |
| Average Mass | 415.530 |
| Monoisotopic Mass | 415.23587 |
| SMILES | C=C1CC[C@@H](O)C(=O)[C@H]2[C@H]1[C@H]1C=C(C)[C@@H](C)[C@H]3[C@H](CC(C)C)NC(=O)[C@]31C(=O)[C@@H]2O |
| InChI | InChI=1S/C24H33NO5/c1-10(2)8-15-19-13(5)12(4)9-14-17-11(3)6-7-16(26)20(27)18(17)21(28)22(29)24(14,19)23(30)25-15/h9-10,13-19,21,26,28H,3,6-8H2,1-2,4-5H3,(H,25,30)/t13-,14-,15+,16-,17-,18-,19+,21-,24+/m1/s1 |
| InChIKey | GWFTZLXZGCZODE-FJYTZTPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (28205583) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavichalasine A (CHEBI:220226) has role fungal metabolite (CHEBI:76946) |
| Flavichalasine A (CHEBI:220226) is a cytochalasin (CHEBI:23528) |